About 5-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]-2-fluorophenol;hydrochloride
5-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]-2-fluorophenol;hydrochloride (PubChem CID 162321777) has the molecular formula C15H15ClFNO
and a molecular weight of 279.74 g/mol. Its IUPAC name is 5-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]-2-fluorophenol;hydrochloride.
Molecular Properties
| Compound Name | 5-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]-2-fluorophenol;hydrochloride |
| PubChem CID | 162321777 |
| Molecular Formula | C15H15ClFNO |
| Molecular Weight | 279.74 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 5-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]-2-fluorophenol;hydrochloride |
| SMILES | Cl.N[C@H]1C[C@@H]1c1ccc(-c2ccc(F)c(O)c2)cc1 |
| InChI | InChI=1S/C15H14FNO.ClH/c16-13-6-5-11(7-15(13)18)9-1-3-10(4-2-9)12-8-14(12)17;/h1-7,12,14,18H,8,17H2;1H/t12-,14+;/m1./s1 |
| InChIKey | XBMAMOYBJTUONE-OJMBIDBESA-N |
| XLogP | 3.43 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.74 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]-2-fluorophenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]-2-fluorophenol;hydrochloride?
The IUPAC name of 5-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]-2-fluorophenol;hydrochloride (CID 162321777) is 5-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]-2-fluorophenol;hydrochloride.
What is the SMILES notation for 5-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]-2-fluorophenol;hydrochloride?
The canonical SMILES for 5-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]-2-fluorophenol;hydrochloride is Cl.N[C@H]1C[C@@H]1c1ccc(-c2ccc(F)c(O)c2)cc1.
What is the InChIKey of 5-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]-2-fluorophenol;hydrochloride?
The InChIKey is XBMAMOYBJTUONE-OJMBIDBESA-N. The full InChI is InChI=1S/C15H14FNO.ClH/c16-13-6-5-11(7-15(13)18)9-1-3-10(4-2-9)12-8-14(12)17;/h1-7,12,14,18H,8,17H2;1H/t12-,14+;/m1./s1.
What are the key properties of 5-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]-2-fluorophenol;hydrochloride?
5-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]-2-fluorophenol;hydrochloride has a molecular weight of 279.74 g/mol, XLogP of 3.43, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]-2-fluorophenol;hydrochloride is sourced from PubChem (CID 162321777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).