C15H25Cl2N3 — CID 162322096
(3R)-1-[2-[[(1S)-2-phenylcyclopropyl]amino]ethyl]pyrrolidin-3-amine;dihydrochloride (PubChem CID 162322096) has the molecular formula C15H25Cl2N3 and a molecular weight of 318.29 g/mol. Its IUPAC name is (3R)-1-[2-[[(1S)-2-phenylcyclopropyl]amino]ethyl]pyrrolidin-3-amine;dihydrochloride.
| Compound Name | (3R)-1-[2-[[(1S)-2-phenylcyclopropyl]amino]ethyl]pyrrolidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 162322096 |
| Molecular Formula | C15H25Cl2N3 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (3R)-1-[2-[[(1S)-2-phenylcyclopropyl]amino]ethyl]pyrrolidin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H]1CCN(CCN[C@H]2CC2c2ccccc2)C1 |
| InChI | InChI=1S/C15H23N3.2ClH/c16-13-6-8-18(11-13)9-7-17-15-10-14(15)12-4-2-1-3-5-12;;/h1-5,13-15,17H,6-11,16H2;2*1H/t13-,14?,15+;;/m1../s1 |
| InChIKey | JUVHCVPXMPUPRN-ZXDZADKHSA-N |
| XLogP | 2.01 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |