About 3-[2-[(1S,2S)-2-aminocyclopropyl]-1,3-thiazol-5-yl]phenol;hydrochloride
3-[2-[(1S,2S)-2-aminocyclopropyl]-1,3-thiazol-5-yl]phenol;hydrochloride (PubChem CID 162323507) has the molecular formula C12H13ClN2OS
and a molecular weight of 268.77 g/mol. Its IUPAC name is 3-[2-[(1S,2S)-2-aminocyclopropyl]-1,3-thiazol-5-yl]phenol;hydrochloride.
Molecular Properties
| Compound Name | 3-[2-[(1S,2S)-2-aminocyclopropyl]-1,3-thiazol-5-yl]phenol;hydrochloride |
| PubChem CID | 162323507 |
| Molecular Formula | C12H13ClN2OS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 3-[2-[(1S,2S)-2-aminocyclopropyl]-1,3-thiazol-5-yl]phenol;hydrochloride |
| SMILES | Cl.N[C@H]1C[C@@H]1c1ncc(-c2cccc(O)c2)s1 |
| InChI | InChI=1S/C12H12N2OS.ClH/c13-10-5-9(10)12-14-6-11(16-12)7-2-1-3-8(15)4-7;/h1-4,6,9-10,15H,5,13H2;1H/t9-,10-;/m0./s1 |
| InChIKey | FHBIBWZHMLZNOF-IYPAPVHQSA-N |
| XLogP | 2.75 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-[(1S,2S)-2-aminocyclopropyl]-1,3-thiazol-5-yl]phenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(1S,2S)-2-aminocyclopropyl]-1,3-thiazol-5-yl]phenol;hydrochloride?
The IUPAC name of 3-[2-[(1S,2S)-2-aminocyclopropyl]-1,3-thiazol-5-yl]phenol;hydrochloride (CID 162323507) is 3-[2-[(1S,2S)-2-aminocyclopropyl]-1,3-thiazol-5-yl]phenol;hydrochloride.
What is the SMILES notation for 3-[2-[(1S,2S)-2-aminocyclopropyl]-1,3-thiazol-5-yl]phenol;hydrochloride?
The canonical SMILES for 3-[2-[(1S,2S)-2-aminocyclopropyl]-1,3-thiazol-5-yl]phenol;hydrochloride is Cl.N[C@H]1C[C@@H]1c1ncc(-c2cccc(O)c2)s1.
What is the InChIKey of 3-[2-[(1S,2S)-2-aminocyclopropyl]-1,3-thiazol-5-yl]phenol;hydrochloride?
The InChIKey is FHBIBWZHMLZNOF-IYPAPVHQSA-N. The full InChI is InChI=1S/C12H12N2OS.ClH/c13-10-5-9(10)12-14-6-11(16-12)7-2-1-3-8(15)4-7;/h1-4,6,9-10,15H,5,13H2;1H/t9-,10-;/m0./s1.
What are the key properties of 3-[2-[(1S,2S)-2-aminocyclopropyl]-1,3-thiazol-5-yl]phenol;hydrochloride?
3-[2-[(1S,2S)-2-aminocyclopropyl]-1,3-thiazol-5-yl]phenol;hydrochloride has a molecular weight of 268.77 g/mol, XLogP of 2.75, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(1S,2S)-2-aminocyclopropyl]-1,3-thiazol-5-yl]phenol;hydrochloride is sourced from PubChem (CID 162323507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).