C14H19ClN4O — CID 162324070
(2-amino-4-methylpyrrolidin-1-yl)-(1-methylindazol-3-yl)methanone;hydrochloride (PubChem CID 162324070) has the molecular formula C14H19ClN4O and a molecular weight of 294.79 g/mol. Its IUPAC name is (2-amino-4-methylpyrrolidin-1-yl)-(1-methylindazol-3-yl)methanone;hydrochloride.
| Compound Name | (2-amino-4-methylpyrrolidin-1-yl)-(1-methylindazol-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 162324070 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (2-amino-4-methylpyrrolidin-1-yl)-(1-methylindazol-3-yl)methanone;hydrochloride |
| SMILES | CC1CC(N)N(C(=O)c2nn(C)c3ccccc23)C1.Cl |
| InChI | InChI=1S/C14H18N4O.ClH/c1-9-7-12(15)18(8-9)14(19)13-10-5-3-4-6-11(10)17(2)16-13;/h3-6,9,12H,7-8,15H2,1-2H3;1H |
| InChIKey | UZFZSPNPPJJLTC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |