C26H29NO9 — CID 162324886
oxalic acid;1-[(4-phenoxyphenyl)methyl]-1,2,3,4,5,6,7,8-octahydroisoquinoline (PubChem CID 162324886) has the molecular formula C26H29NO9 and a molecular weight of 499.52 g/mol. Its IUPAC name is oxalic acid;1-[(4-phenoxyphenyl)methyl]-1,2,3,4,5,6,7,8-octahydroisoquinoline.
| Compound Name | oxalic acid;1-[(4-phenoxyphenyl)methyl]-1,2,3,4,5,6,7,8-octahydroisoquinoline |
|---|---|
| PubChem CID | 162324886 |
| Molecular Formula | C26H29NO9 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | oxalic acid;1-[(4-phenoxyphenyl)methyl]-1,2,3,4,5,6,7,8-octahydroisoquinoline |
| SMILES | O=C(O)C(=O)O.O=C(O)C(=O)O.c1ccc(Oc2ccc(CC3NCCC4=C3CCCC4)cc2)cc1 |
| InChI | InChI=1S/C22H25NO.2C2H2O4/c1-2-7-19(8-3-1)24-20-12-10-17(11-13-20)16-22-21-9-5-4-6-18(21)14-15-23-22;2*3-1(4)2(5)6/h1-3,7-8,10-13,22-23H,4-6,9,14-16H2;2*(H,3,4)(H,5,6) |
| InChIKey | ZDNXRLLSEKBTNR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 170.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|