C25H33NO3 — CID 162326242
4-[(E,3E)-3-hydroxyimino-3-(4,4,7,7,10-pentamethylcyclodeca-1,9-dien-1-yl)prop-1-enyl]benzoic acid (PubChem CID 162326242) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is 4-[(E,3E)-3-hydroxyimino-3-(4,4,7,7,10-pentamethylcyclodeca-1,9-dien-1-yl)prop-1-enyl]benzoic acid.
| Compound Name | 4-[(E,3E)-3-hydroxyimino-3-(4,4,7,7,10-pentamethylcyclodeca-1,9-dien-1-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 162326242 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | 4-[(E,3E)-3-hydroxyimino-3-(4,4,7,7,10-pentamethylcyclodeca-1,9-dien-1-yl)prop-1-enyl]benzoic acid |
| SMILES | CC1=CCC(C)(C)CCC(C)(C)CC=C1C(/C=C/c1ccc(C(=O)O)cc1)=N/O |
| InChI | InChI=1S/C25H33NO3/c1-18-12-14-24(2,3)16-17-25(4,5)15-13-21(18)22(26-29)11-8-19-6-9-20(10-7-19)23(27)28/h6-13,29H,14-17H2,1-5H3,(H,27,28)/b11-8+,18-12?,21-13?,26-22+ |
| InChIKey | PQBQGGQGEWTRSG-LSWZQYARSA-N |
| XLogP | 6.73 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|