C11H15Cl2NO — CID 162326709
2-(chloromethyl)-4-(2-cyclopropylethoxy)pyridine;hydrochloride (PubChem CID 162326709) has the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. Its IUPAC name is 2-(chloromethyl)-4-(2-cyclopropylethoxy)pyridine;hydrochloride.
| Compound Name | 2-(chloromethyl)-4-(2-cyclopropylethoxy)pyridine;hydrochloride |
|---|---|
| PubChem CID | 162326709 |
| Molecular Formula | C11H15Cl2NO |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-(chloromethyl)-4-(2-cyclopropylethoxy)pyridine;hydrochloride |
| SMILES | Cl.ClCc1cc(OCCC2CC2)ccn1 |
| InChI | InChI=1S/C11H14ClNO.ClH/c12-8-10-7-11(3-5-13-10)14-6-4-9-1-2-9;/h3,5,7,9H,1-2,4,6,8H2;1H |
| InChIKey | PFAROUUDYBQXKV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|