C11H16ClF3N2O3 — CID 162327213
(3R,4S)-3-(2-amino-4,4,4-trifluoro-3-methylbutanoyl)-1,4-dimethylpyrrolidine-2,5-dione;hydrochloride (PubChem CID 162327213) has the molecular formula C11H16ClF3N2O3 and a molecular weight of 316.71 g/mol. Its IUPAC name is (3R,4S)-3-(2-amino-4,4,4-trifluoro-3-methylbutanoyl)-1,4-dimethylpyrrolidine-2,5-dione;hydrochloride.
| Compound Name | (3R,4S)-3-(2-amino-4,4,4-trifluoro-3-methylbutanoyl)-1,4-dimethylpyrrolidine-2,5-dione;hydrochloride |
|---|---|
| PubChem CID | 162327213 |
| Molecular Formula | C11H16ClF3N2O3 |
| Molecular Weight | 316.71 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | (3R,4S)-3-(2-amino-4,4,4-trifluoro-3-methylbutanoyl)-1,4-dimethylpyrrolidine-2,5-dione;hydrochloride |
| SMILES | CC(C(N)C(=O)[C@@H]1C(=O)N(C)C(=O)[C@H]1C)C(F)(F)F.Cl |
| InChI | InChI=1S/C11H15F3N2O3.ClH/c1-4-6(10(19)16(3)9(4)18)8(17)7(15)5(2)11(12,13)14;/h4-7H,15H2,1-3H3;1H/t4-,5?,6+,7?;/m0./s1 |
| InChIKey | BDBFECJPWDXBRU-KCICFFMXSA-N |
| XLogP | 0.75 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.71 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|