C26H24F6N4O5 — CID 162327346
[3-[2-[(4-methanehydrazonoylphenyl)methoxymethyl]phenyl]phenyl]methylidenehydrazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 162327346) has the molecular formula C26H24F6N4O5 and a molecular weight of 586.49 g/mol. Its IUPAC name is [3-[2-[(4-methanehydrazonoylphenyl)methoxymethyl]phenyl]phenyl]methylidenehydrazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [3-[2-[(4-methanehydrazonoylphenyl)methoxymethyl]phenyl]phenyl]methylidenehydrazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 162327346 |
| Molecular Formula | C26H24F6N4O5 |
| Molecular Weight | 586.49 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | [3-[2-[(4-methanehydrazonoylphenyl)methoxymethyl]phenyl]phenyl]methylidenehydrazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NN=Cc1ccc(COCc2ccccc2-c2cccc(C=NN)c2)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H22N4O.2C2HF3O2/c23-25-13-17-8-10-18(11-9-17)15-27-16-21-5-1-2-7-22(21)20-6-3-4-19(12-20)14-26-24;2*3-2(4,5)1(6)7/h1-14H,15-16,23-24H2;2*(H,6,7) |
| InChIKey | VJXSRWWZVWNZHW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 160.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|