About 4-[[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]amino]phenol;hydrochloride
4-[[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]amino]phenol;hydrochloride (PubChem CID 162328536) has the molecular formula C14H16ClN3O
and a molecular weight of 277.76 g/mol. Its IUPAC name is 4-[[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]amino]phenol;hydrochloride.
Molecular Properties
| Compound Name | 4-[[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]amino]phenol;hydrochloride |
| PubChem CID | 162328536 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-[[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]amino]phenol;hydrochloride |
| SMILES | Cl.N[C@H]1C[C@@H]1c1ccc(Nc2ccc(O)cc2)nc1 |
| InChI | InChI=1S/C14H15N3O.ClH/c15-13-7-12(13)9-1-6-14(16-8-9)17-10-2-4-11(18)5-3-10;/h1-6,8,12-13,18H,7,15H2,(H,16,17);1H/t12-,13+;/m1./s1 |
| InChIKey | WWRXBNHAOVGEDI-KZCZEQIWSA-N |
| XLogP | 2.77 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-[[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]amino]phenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]amino]phenol;hydrochloride?
The IUPAC name of 4-[[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]amino]phenol;hydrochloride (CID 162328536) is 4-[[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]amino]phenol;hydrochloride.
What is the SMILES notation for 4-[[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]amino]phenol;hydrochloride?
The canonical SMILES for 4-[[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]amino]phenol;hydrochloride is Cl.N[C@H]1C[C@@H]1c1ccc(Nc2ccc(O)cc2)nc1.
What is the InChIKey of 4-[[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]amino]phenol;hydrochloride?
The InChIKey is WWRXBNHAOVGEDI-KZCZEQIWSA-N. The full InChI is InChI=1S/C14H15N3O.ClH/c15-13-7-12(13)9-1-6-14(16-8-9)17-10-2-4-11(18)5-3-10;/h1-6,8,12-13,18H,7,15H2,(H,16,17);1H/t12-,13+;/m1./s1.
What are the key properties of 4-[[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]amino]phenol;hydrochloride?
4-[[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]amino]phenol;hydrochloride has a molecular weight of 277.76 g/mol, XLogP of 2.77, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]amino]phenol;hydrochloride is sourced from PubChem (CID 162328536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).