C18H30BCl2N3O3 — CID 162329338
[(2R)-1-[(2S)-2-[(1-benzylpyrrolidin-3-yl)amino]propanoyl]pyrrolidin-2-yl]boronic acid;dihydrochloride (PubChem CID 162329338) has the molecular formula C18H30BCl2N3O3 and a molecular weight of 418.17 g/mol. Its IUPAC name is [(2R)-1-[(2S)-2-[(1-benzylpyrrolidin-3-yl)amino]propanoyl]pyrrolidin-2-yl]boronic acid;dihydrochloride.
| Compound Name | [(2R)-1-[(2S)-2-[(1-benzylpyrrolidin-3-yl)amino]propanoyl]pyrrolidin-2-yl]boronic acid;dihydrochloride |
|---|---|
| PubChem CID | 162329338 |
| Molecular Formula | C18H30BCl2N3O3 |
| Molecular Weight | 418.17 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | [(2R)-1-[(2S)-2-[(1-benzylpyrrolidin-3-yl)amino]propanoyl]pyrrolidin-2-yl]boronic acid;dihydrochloride |
| SMILES | C[C@H](NC1CCN(Cc2ccccc2)C1)C(=O)N1CCC[C@H]1B(O)O.Cl.Cl |
| InChI | InChI=1S/C18H28BN3O3.2ClH/c1-14(18(23)22-10-5-8-17(22)19(24)25)20-16-9-11-21(13-16)12-15-6-3-2-4-7-15;;/h2-4,6-7,14,16-17,20,24-25H,5,8-13H2,1H3;2*1H/t14-,16?,17-;;/m0../s1 |
| InChIKey | HVZLQDUKUKWNLW-VTEGRQGWSA-N |
| XLogP | 1.09 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|