About 3-methylidenepentane;hydrate
3-methylidenepentane;hydrate (PubChem CID 162329688) has the molecular formula C6H14O
and a molecular weight of 102.18 g/mol. Its IUPAC name is 3-methylidenepentane;hydrate.
Molecular Properties
| Compound Name | 3-methylidenepentane;hydrate |
| PubChem CID | 162329688 |
| Molecular Formula | C6H14O |
| Molecular Weight | 102.18 g/mol |
| Exact Mass | 102.10 |
| IUPAC Name | 3-methylidenepentane;hydrate |
| SMILES | C=C(CC)CC.O |
| InChI | InChI=1S/C6H12.H2O/c1-4-6(3)5-2;/h3-5H2,1-2H3;1H2 |
| InChIKey | AHNLSGLIUYEXCZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylidenepentane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidenepentane;hydrate?
The IUPAC name of 3-methylidenepentane;hydrate (CID 162329688) is 3-methylidenepentane;hydrate.
What is the SMILES notation for 3-methylidenepentane;hydrate?
The canonical SMILES for 3-methylidenepentane;hydrate is C=C(CC)CC.O.
What is the InChIKey of 3-methylidenepentane;hydrate?
The InChIKey is AHNLSGLIUYEXCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.H2O/c1-4-6(3)5-2;/h3-5H2,1-2H3;1H2.
What are the key properties of 3-methylidenepentane;hydrate?
3-methylidenepentane;hydrate has a molecular weight of 102.18 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidenepentane;hydrate is sourced from PubChem (CID 162329688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).