C18H26F3N3O7 — CID 162330520
tert-butyl (2S)-6-amino-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoate;2,2,2-trifluoroacetic acid (PubChem CID 162330520) has the molecular formula C18H26F3N3O7 and a molecular weight of 453.41 g/mol. Its IUPAC name is tert-butyl (2S)-6-amino-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoate;2,2,2-trifluoroacetic acid.
| Compound Name | tert-butyl (2S)-6-amino-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162330520 |
| Molecular Formula | C18H26F3N3O7 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | tert-butyl (2S)-6-amino-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCCN)NC(=O)CN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N3O5.C2HF3O2/c1-16(2,3)24-15(23)11(6-4-5-9-17)18-12(20)10-19-13(21)7-8-14(19)22;3-2(4,5)1(6)7/h7-8,11H,4-6,9-10,17H2,1-3H3,(H,18,20);(H,6,7)/t11-;/m0./s1 |
| InChIKey | NQQYYEUEGHCKAU-MERQFXBCSA-N |
| XLogP | 0.50 |
| TPSA | 156.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|