C16H14F7N3O4 — CID 162330923
4-[(4-amino-2-fluorophenyl)methyl]pyridin-2-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 162330923) has the molecular formula C16H14F7N3O4 and a molecular weight of 445.29 g/mol. Its IUPAC name is 4-[(4-amino-2-fluorophenyl)methyl]pyridin-2-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[(4-amino-2-fluorophenyl)methyl]pyridin-2-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 162330923 |
| Molecular Formula | C16H14F7N3O4 |
| Molecular Weight | 445.29 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 4-[(4-amino-2-fluorophenyl)methyl]pyridin-2-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Nc1ccc(Cc2ccnc(N)c2)c(F)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H12FN3.2C2HF3O2/c13-11-7-10(14)2-1-9(11)5-8-3-4-16-12(15)6-8;2*3-2(4,5)1(6)7/h1-4,6-7H,5,14H2,(H2,15,16);2*(H,6,7) |
| InChIKey | WXTCUJZMJSIGTE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 139.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|