About 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine;dihydrochloride
7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine;dihydrochloride (PubChem CID 162331239) has the molecular formula C7H8Cl2FN3
and a molecular weight of 224.07 g/mol. Its IUPAC name is 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine;dihydrochloride.
Molecular Properties
| Compound Name | 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine;dihydrochloride |
| PubChem CID | 162331239 |
| Molecular Formula | C7H8Cl2FN3 |
| Molecular Weight | 224.07 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1cnc2c(c1F)=NCC=2 |
| InChI | InChI=1S/C7H6FN3.2ClH/c8-6-4(9)3-11-5-1-2-10-7(5)6;;/h1,3H,2,9H2;2*1H |
| InChIKey | GOWDJMZYADPGSC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.07 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine;dihydrochloride?
The IUPAC name of 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine;dihydrochloride (CID 162331239) is 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine;dihydrochloride.
What is the SMILES notation for 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine;dihydrochloride?
The canonical SMILES for 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine;dihydrochloride is Cl.Cl.Nc1cnc2c(c1F)=NCC=2.
What is the InChIKey of 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine;dihydrochloride?
The InChIKey is GOWDJMZYADPGSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FN3.2ClH/c8-6-4(9)3-11-5-1-2-10-7(5)6;;/h1,3H,2,9H2;2*1H.
What are the key properties of 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine;dihydrochloride?
7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine;dihydrochloride has a molecular weight of 224.07 g/mol, XLogP of 0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2H-pyrrolo[3,2-b]pyridin-6-amine;dihydrochloride is sourced from PubChem (CID 162331239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).