About CID 162331627
CID 162331627 (PubChem CID 162331627) has the molecular formula C2H5NNaO2
and a molecular weight of 98.06 g/mol.
Molecular Properties
| Compound Name | CID 162331627 |
| PubChem CID | 162331627 |
| Molecular Formula | C2H5NNaO2 |
| Molecular Weight | 98.06 g/mol |
| Exact Mass | 98.02 |
| IUPAC Name | — |
| SMILES | NC(=O)CO.[Na] |
| InChI | InChI=1S/C2H5NO2.Na/c3-2(5)1-4;/h4H,1H2,(H2,3,5); |
| InChIKey | NZDXKEYUCVSWOW-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.06 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 162331627 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162331627?
The IUPAC name of CID 162331627 (CID 162331627) is not available.
What is the SMILES notation for CID 162331627?
The canonical SMILES for CID 162331627 is NC(=O)CO.[Na].
What is the InChIKey of CID 162331627?
The InChIKey is NZDXKEYUCVSWOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.Na/c3-2(5)1-4;/h4H,1H2,(H2,3,5);.
What are the key properties of CID 162331627?
CID 162331627 has a molecular weight of 98.06 g/mol, XLogP of -1.92, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162331627 is sourced from PubChem (CID 162331627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).