C7H13ClN2O — CID 162333644
N-[1-(1,2,3,6-tetrahydropyridin-5-yl)ethylidene]hydroxylamine;hydrochloride (PubChem CID 162333644) has the molecular formula C7H13ClN2O and a molecular weight of 176.65 g/mol. Its IUPAC name is N-[1-(1,2,3,6-tetrahydropyridin-5-yl)ethylidene]hydroxylamine;hydrochloride.
| Compound Name | N-[1-(1,2,3,6-tetrahydropyridin-5-yl)ethylidene]hydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 162333644 |
| Molecular Formula | C7H13ClN2O |
| Molecular Weight | 176.65 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | N-[1-(1,2,3,6-tetrahydropyridin-5-yl)ethylidene]hydroxylamine;hydrochloride |
| SMILES | CC(=NO)C1=CCCNC1.Cl |
| InChI | InChI=1S/C7H12N2O.ClH/c1-6(9-10)7-3-2-4-8-5-7;/h3,8,10H,2,4-5H2,1H3;1H |
| InChIKey | NNXXRTSADMNBPT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.65 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|