C12H10F3N3O5 — CID 162334019
3-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate (PubChem CID 162334019) has the molecular formula C12H10F3N3O5 and a molecular weight of 333.22 g/mol. Its IUPAC name is 3-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate.
| Compound Name | 3-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 162334019 |
| Molecular Formula | C12H10F3N3O5 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 3-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate |
| SMILES | O=C(O)CC[n+]1ccc(-c2ncco2)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C10H9N3O3.C2HF3O2/c14-9(15)2-5-13-4-1-8(7-12-13)10-11-3-6-16-10;3-2(4,5)1(6)7/h1,3-4,6-7H,2,5H2;(H,6,7) |
| InChIKey | ZFSRNKWCGNAXOP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 120.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|