C16H26ClNO — CID 162334204
1-cyclohexyl-2-(2,6-dimethylphenoxy)ethanamine;hydrochloride (PubChem CID 162334204) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is 1-cyclohexyl-2-(2,6-dimethylphenoxy)ethanamine;hydrochloride.
| Compound Name | 1-cyclohexyl-2-(2,6-dimethylphenoxy)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 162334204 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-cyclohexyl-2-(2,6-dimethylphenoxy)ethanamine;hydrochloride |
| SMILES | Cc1cccc(C)c1OCC(N)C1CCCCC1.Cl |
| InChI | InChI=1S/C16H25NO.ClH/c1-12-7-6-8-13(2)16(12)18-11-15(17)14-9-4-3-5-10-14;/h6-8,14-15H,3-5,9-11,17H2,1-2H3;1H |
| InChIKey | ZJKIXVLPCSDKIT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |