About N-[(3,5-dichloro-4-isocyanatophenyl)methyl]-N-propan-2-ylpropan-2-amine;hydrochloride
N-[(3,5-dichloro-4-isocyanatophenyl)methyl]-N-propan-2-ylpropan-2-amine;hydrochloride (PubChem CID 162335034) has the molecular formula C14H19Cl3N2O
and a molecular weight of 337.68 g/mol. Its IUPAC name is N-[(3,5-dichloro-4-isocyanatophenyl)methyl]-N-propan-2-ylpropan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-[(3,5-dichloro-4-isocyanatophenyl)methyl]-N-propan-2-ylpropan-2-amine;hydrochloride |
| PubChem CID | 162335034 |
| Molecular Formula | C14H19Cl3N2O |
| Molecular Weight | 337.68 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-[(3,5-dichloro-4-isocyanatophenyl)methyl]-N-propan-2-ylpropan-2-amine;hydrochloride |
| SMILES | CC(C)N(Cc1cc(Cl)c(N=C=O)c(Cl)c1)C(C)C.Cl |
| InChI | InChI=1S/C14H18Cl2N2O.ClH/c1-9(2)18(10(3)4)7-11-5-12(15)14(17-8-19)13(16)6-11;/h5-6,9-10H,7H2,1-4H3;1H |
| InChIKey | JYXJNOZWMHGUNR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.68 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,5-dichloro-4-isocyanatophenyl)methyl]-N-propan-2-ylpropan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dichloro-4-isocyanatophenyl)methyl]-N-propan-2-ylpropan-2-amine;hydrochloride?
The IUPAC name of N-[(3,5-dichloro-4-isocyanatophenyl)methyl]-N-propan-2-ylpropan-2-amine;hydrochloride (CID 162335034) is N-[(3,5-dichloro-4-isocyanatophenyl)methyl]-N-propan-2-ylpropan-2-amine;hydrochloride.
What is the SMILES notation for N-[(3,5-dichloro-4-isocyanatophenyl)methyl]-N-propan-2-ylpropan-2-amine;hydrochloride?
The canonical SMILES for N-[(3,5-dichloro-4-isocyanatophenyl)methyl]-N-propan-2-ylpropan-2-amine;hydrochloride is CC(C)N(Cc1cc(Cl)c(N=C=O)c(Cl)c1)C(C)C.Cl.
What is the InChIKey of N-[(3,5-dichloro-4-isocyanatophenyl)methyl]-N-propan-2-ylpropan-2-amine;hydrochloride?
The InChIKey is JYXJNOZWMHGUNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18Cl2N2O.ClH/c1-9(2)18(10(3)4)7-11-5-12(15)14(17-8-19)13(16)6-11;/h5-6,9-10H,7H2,1-4H3;1H.
What are the key properties of N-[(3,5-dichloro-4-isocyanatophenyl)methyl]-N-propan-2-ylpropan-2-amine;hydrochloride?
N-[(3,5-dichloro-4-isocyanatophenyl)methyl]-N-propan-2-ylpropan-2-amine;hydrochloride has a molecular weight of 337.68 g/mol, XLogP of 5.00, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dichloro-4-isocyanatophenyl)methyl]-N-propan-2-ylpropan-2-amine;hydrochloride is sourced from PubChem (CID 162335034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).