About 4-fluoro-N-methyl-2-(1,2,4-triazol-1-yl)aniline;hydrochloride
4-fluoro-N-methyl-2-(1,2,4-triazol-1-yl)aniline;hydrochloride (PubChem CID 162335623) has the molecular formula C9H10ClFN4
and a molecular weight of 228.66 g/mol. Its IUPAC name is 4-fluoro-N-methyl-2-(1,2,4-triazol-1-yl)aniline;hydrochloride.
Molecular Properties
| Compound Name | 4-fluoro-N-methyl-2-(1,2,4-triazol-1-yl)aniline;hydrochloride |
| PubChem CID | 162335623 |
| Molecular Formula | C9H10ClFN4 |
| Molecular Weight | 228.66 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 4-fluoro-N-methyl-2-(1,2,4-triazol-1-yl)aniline;hydrochloride |
| SMILES | CNc1ccc(F)cc1-n1cncn1.Cl |
| InChI | InChI=1S/C9H9FN4.ClH/c1-11-8-3-2-7(10)4-9(8)14-6-12-5-13-14;/h2-6,11H,1H3;1H |
| InChIKey | KCHICZDYVQNHGI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.66 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-fluoro-N-methyl-2-(1,2,4-triazol-1-yl)aniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-methyl-2-(1,2,4-triazol-1-yl)aniline;hydrochloride?
The IUPAC name of 4-fluoro-N-methyl-2-(1,2,4-triazol-1-yl)aniline;hydrochloride (CID 162335623) is 4-fluoro-N-methyl-2-(1,2,4-triazol-1-yl)aniline;hydrochloride.
What is the SMILES notation for 4-fluoro-N-methyl-2-(1,2,4-triazol-1-yl)aniline;hydrochloride?
The canonical SMILES for 4-fluoro-N-methyl-2-(1,2,4-triazol-1-yl)aniline;hydrochloride is CNc1ccc(F)cc1-n1cncn1.Cl.
What is the InChIKey of 4-fluoro-N-methyl-2-(1,2,4-triazol-1-yl)aniline;hydrochloride?
The InChIKey is KCHICZDYVQNHGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN4.ClH/c1-11-8-3-2-7(10)4-9(8)14-6-12-5-13-14;/h2-6,11H,1H3;1H.
What are the key properties of 4-fluoro-N-methyl-2-(1,2,4-triazol-1-yl)aniline;hydrochloride?
4-fluoro-N-methyl-2-(1,2,4-triazol-1-yl)aniline;hydrochloride has a molecular weight of 228.66 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-methyl-2-(1,2,4-triazol-1-yl)aniline;hydrochloride is sourced from PubChem (CID 162335623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).