C21H23F3N4O5S — CID 162335740
acetic acid;3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carbonyl]benzenecarboximidamide (PubChem CID 162335740) has the molecular formula C21H23F3N4O5S and a molecular weight of 500.50 g/mol. Its IUPAC name is acetic acid;3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carbonyl]benzenecarboximidamide.
| Compound Name | acetic acid;3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carbonyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 162335740 |
| Molecular Formula | C21H23F3N4O5S |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | acetic acid;3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carbonyl]benzenecarboximidamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1cccc(C(=O)N2CCN(S(=O)(=O)c3cccc(C(F)(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C19H19F3N4O3S.C2H4O2/c20-19(21,22)15-5-2-6-16(12-15)30(28,29)26-9-7-25(8-10-26)18(27)14-4-1-3-13(11-14)17(23)24;1-2(3)4/h1-6,11-12H,7-10H2,(H3,23,24);1H3,(H,3,4) |
| InChIKey | UGJSMFCPLDDBMY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|