About CID 162335780
CID 162335780 (PubChem CID 162335780) has the molecular formula C10H14NaO4
and a molecular weight of 221.21 g/mol.
Molecular Properties
| Compound Name | CID 162335780 |
| PubChem CID | 162335780 |
| Molecular Formula | C10H14NaO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | — |
| SMILES | OCCOc1ccc(OCCO)cc1.[Na] |
| InChI | InChI=1S/C10H14O4.Na/c11-5-7-13-9-1-2-10(4-3-9)14-8-6-12;/h1-4,11-12H,5-8H2; |
| InChIKey | NTOWVJMLVPDIIV-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 162335780 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162335780?
The IUPAC name of CID 162335780 (CID 162335780) is not available.
What is the SMILES notation for CID 162335780?
The canonical SMILES for CID 162335780 is OCCOc1ccc(OCCO)cc1.[Na].
What is the InChIKey of CID 162335780?
The InChIKey is NTOWVJMLVPDIIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4.Na/c11-5-7-13-9-1-2-10(4-3-9)14-8-6-12;/h1-4,11-12H,5-8H2;.
What are the key properties of CID 162335780?
CID 162335780 has a molecular weight of 221.21 g/mol, XLogP of 0.05, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162335780 is sourced from PubChem (CID 162335780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).