C16H13F3N2O4 — CID 162335816
4-amino-1,2-dimethylphenoxazin-3-one;2,2,2-trifluoroacetic acid (PubChem CID 162335816) has the molecular formula C16H13F3N2O4 and a molecular weight of 354.28 g/mol. Its IUPAC name is 4-amino-1,2-dimethylphenoxazin-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 4-amino-1,2-dimethylphenoxazin-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162335816 |
| Molecular Formula | C16H13F3N2O4 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 4-amino-1,2-dimethylphenoxazin-3-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1c2nc3ccccc3oc-2c(N)c(=O)c1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H12N2O2.C2HF3O2/c1-7-8(2)13(17)11(15)14-12(7)16-9-5-3-4-6-10(9)18-14;3-2(4,5)1(6)7/h3-6H,15H2,1-2H3;(H,6,7) |
| InChIKey | XVOLPAWJDDDAMA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|