About 3-(4-aminosulfanylphenyl)-1-(2-methylphenyl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate
3-(4-aminosulfanylphenyl)-1-(2-methylphenyl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate (PubChem CID 162337107) has the molecular formula C19H20N4O3S
and a molecular weight of 384.46 g/mol. Its IUPAC name is 3-(4-aminosulfanylphenyl)-1-(2-methylphenyl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate.
Molecular Properties
| Compound Name | 3-(4-aminosulfanylphenyl)-1-(2-methylphenyl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate |
| PubChem CID | 162337107 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 3-(4-aminosulfanylphenyl)-1-(2-methylphenyl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate |
| SMILES | Cc1ccccc1-n1nc(-c2ccc(SN)cc2)c2c(=O)[nH]ccc21.O.O |
| InChI | InChI=1S/C19H16N4OS.2H2O/c1-12-4-2-3-5-15(12)23-16-10-11-21-19(24)17(16)18(22-23)13-6-8-14(25-20)9-7-13;;/h2-11H,20H2,1H3,(H,21,24);2*1H2 |
| InChIKey | DXGKSELSJGKDLG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-aminosulfanylphenyl)-1-(2-methylphenyl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminosulfanylphenyl)-1-(2-methylphenyl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate?
The IUPAC name of 3-(4-aminosulfanylphenyl)-1-(2-methylphenyl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate (CID 162337107) is 3-(4-aminosulfanylphenyl)-1-(2-methylphenyl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate.
What is the SMILES notation for 3-(4-aminosulfanylphenyl)-1-(2-methylphenyl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate?
The canonical SMILES for 3-(4-aminosulfanylphenyl)-1-(2-methylphenyl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate is Cc1ccccc1-n1nc(-c2ccc(SN)cc2)c2c(=O)[nH]ccc21.O.O.
What is the InChIKey of 3-(4-aminosulfanylphenyl)-1-(2-methylphenyl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate?
The InChIKey is DXGKSELSJGKDLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4OS.2H2O/c1-12-4-2-3-5-15(12)23-16-10-11-21-19(24)17(16)18(22-23)13-6-8-14(25-20)9-7-13;;/h2-11H,20H2,1H3,(H,21,24);2*1H2.
What are the key properties of 3-(4-aminosulfanylphenyl)-1-(2-methylphenyl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate?
3-(4-aminosulfanylphenyl)-1-(2-methylphenyl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate has a molecular weight of 384.46 g/mol, XLogP of 2.01, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminosulfanylphenyl)-1-(2-methylphenyl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate is sourced from PubChem (CID 162337107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).