C14H28ClN5O — CID 162337473
N-[amino-(4-methoxypiperidin-1-yl)methylidene]-3-methylpiperidine-1-carboximidamide;hydrochloride (PubChem CID 162337473) has the molecular formula C14H28ClN5O and a molecular weight of 317.87 g/mol. Its IUPAC name is N-[amino-(4-methoxypiperidin-1-yl)methylidene]-3-methylpiperidine-1-carboximidamide;hydrochloride.
| Compound Name | N-[amino-(4-methoxypiperidin-1-yl)methylidene]-3-methylpiperidine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 162337473 |
| Molecular Formula | C14H28ClN5O |
| Molecular Weight | 317.87 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | N-[amino-(4-methoxypiperidin-1-yl)methylidene]-3-methylpiperidine-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(/N=C(N)N1CCC(OC)CC1)N1CCCC(C)C1 |
| InChI | InChI=1S/C14H27N5O.ClH/c1-11-4-3-7-19(10-11)14(16)17-13(15)18-8-5-12(20-2)6-9-18;/h11-12H,3-10H2,1-2H3,(H3,15,16,17);1H |
| InChIKey | CZZXEEFBKCFCLA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.87 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|