C25H27N3O7 — CID 162339182
(Z)-but-2-enedioic acid;methyl 2-methoxy-5-[[[(1S)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]amino]methyl]benzoate (PubChem CID 162339182) has the molecular formula C25H27N3O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;methyl 2-methoxy-5-[[[(1S)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]amino]methyl]benzoate.
| Compound Name | (Z)-but-2-enedioic acid;methyl 2-methoxy-5-[[[(1S)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 162339182 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (Z)-but-2-enedioic acid;methyl 2-methoxy-5-[[[(1S)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1cc(CN[C@@H](C)c2ncc(-c3ccccc3)[nH]2)ccc1OC.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H23N3O3.C4H4O4/c1-14(20-23-13-18(24-20)16-7-5-4-6-8-16)22-12-15-9-10-19(26-2)17(11-15)21(25)27-3;5-3(6)1-2-4(7)8/h4-11,13-14,22H,12H2,1-3H3,(H,23,24);1-2H,(H,5,6)(H,7,8)/b;2-1-/t14-;/m0./s1 |
| InChIKey | RTOCEWDNWFQZCP-FXSDFHGDSA-N |
| XLogP | 3.43 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|