C17H19NO5 — CID 162339346
1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;(Z)-but-2-enedioic acid (PubChem CID 162339346) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;(Z)-but-2-enedioic acid.
| Compound Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 162339346 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;(Z)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C\C(=O)O.OC1CCC2NC=c3ccccc3=C2C1 |
| InChI | InChI=1S/C13H15NO.C4H4O4/c15-10-5-6-13-12(7-10)11-4-2-1-3-9(11)8-14-13;5-3(6)1-2-4(7)8/h1-4,8,10,13-15H,5-7H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | DAVATSQKZCKYNH-BTJKTKAUSA-N |
| XLogP | -0.20 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|