C16H20ClNO — CID 162339872
2-(3,4-dimethylphenoxy)-1-phenylethanamine;hydrochloride (PubChem CID 162339872) has the molecular formula C16H20ClNO and a molecular weight of 277.80 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-1-phenylethanamine;hydrochloride.
| Compound Name | 2-(3,4-dimethylphenoxy)-1-phenylethanamine;hydrochloride |
|---|---|
| PubChem CID | 162339872 |
| Molecular Formula | C16H20ClNO |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-1-phenylethanamine;hydrochloride |
| SMILES | Cc1ccc(OCC(N)c2ccccc2)cc1C.Cl |
| InChI | InChI=1S/C16H19NO.ClH/c1-12-8-9-15(10-13(12)2)18-11-16(17)14-6-4-3-5-7-14;/h3-10,16H,11,17H2,1-2H3;1H |
| InChIKey | WKEUEYBIQWQBHA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |