About 4-(3-azabicyclo[3.1.0]hexan-1-yl)-2-(trifluoromethyl)-1,3-thiazole;hydrochloride
4-(3-azabicyclo[3.1.0]hexan-1-yl)-2-(trifluoromethyl)-1,3-thiazole;hydrochloride (PubChem CID 162339887) has the molecular formula C9H10ClF3N2S
and a molecular weight of 270.71 g/mol. Its IUPAC name is 4-(3-azabicyclo[3.1.0]hexan-1-yl)-2-(trifluoromethyl)-1,3-thiazole;hydrochloride.
Molecular Properties
| Compound Name | 4-(3-azabicyclo[3.1.0]hexan-1-yl)-2-(trifluoromethyl)-1,3-thiazole;hydrochloride |
| PubChem CID | 162339887 |
| Molecular Formula | C9H10ClF3N2S |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 4-(3-azabicyclo[3.1.0]hexan-1-yl)-2-(trifluoromethyl)-1,3-thiazole;hydrochloride |
| SMILES | Cl.FC(F)(F)c1nc(C23CNCC2C3)cs1 |
| InChI | InChI=1S/C9H9F3N2S.ClH/c10-9(11,12)7-14-6(3-15-7)8-1-5(8)2-13-4-8;/h3,5,13H,1-2,4H2;1H |
| InChIKey | DECJAILXQFFDGH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-azabicyclo[3.1.0]hexan-1-yl)-2-(trifluoromethyl)-1,3-thiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-azabicyclo[3.1.0]hexan-1-yl)-2-(trifluoromethyl)-1,3-thiazole;hydrochloride?
The IUPAC name of 4-(3-azabicyclo[3.1.0]hexan-1-yl)-2-(trifluoromethyl)-1,3-thiazole;hydrochloride (CID 162339887) is 4-(3-azabicyclo[3.1.0]hexan-1-yl)-2-(trifluoromethyl)-1,3-thiazole;hydrochloride.
What is the SMILES notation for 4-(3-azabicyclo[3.1.0]hexan-1-yl)-2-(trifluoromethyl)-1,3-thiazole;hydrochloride?
The canonical SMILES for 4-(3-azabicyclo[3.1.0]hexan-1-yl)-2-(trifluoromethyl)-1,3-thiazole;hydrochloride is Cl.FC(F)(F)c1nc(C23CNCC2C3)cs1.
What is the InChIKey of 4-(3-azabicyclo[3.1.0]hexan-1-yl)-2-(trifluoromethyl)-1,3-thiazole;hydrochloride?
The InChIKey is DECJAILXQFFDGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3N2S.ClH/c10-9(11,12)7-14-6(3-15-7)8-1-5(8)2-13-4-8;/h3,5,13H,1-2,4H2;1H.
What are the key properties of 4-(3-azabicyclo[3.1.0]hexan-1-yl)-2-(trifluoromethyl)-1,3-thiazole;hydrochloride?
4-(3-azabicyclo[3.1.0]hexan-1-yl)-2-(trifluoromethyl)-1,3-thiazole;hydrochloride has a molecular weight of 270.71 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-azabicyclo[3.1.0]hexan-1-yl)-2-(trifluoromethyl)-1,3-thiazole;hydrochloride is sourced from PubChem (CID 162339887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).