C22H28N4O5S — CID 162340095
2-[4-(6-amino-5-methyl-3-pyridinyl)phenyl]-N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide;methanesulfonic acid (PubChem CID 162340095) has the molecular formula C22H28N4O5S and a molecular weight of 460.56 g/mol. Its IUPAC name is 2-[4-(6-amino-5-methyl-3-pyridinyl)phenyl]-N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide;methanesulfonic acid.
| Compound Name | 2-[4-(6-amino-5-methyl-3-pyridinyl)phenyl]-N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide;methanesulfonic acid |
|---|---|
| PubChem CID | 162340095 |
| Molecular Formula | C22H28N4O5S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 2-[4-(6-amino-5-methyl-3-pyridinyl)phenyl]-N-(5-tert-butyl-1,2-oxazol-3-yl)acetamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1cc(-c2ccc(CC(=O)Nc3cc(C(C)(C)C)on3)cc2)cnc1N |
| InChI | InChI=1S/C21H24N4O2.CH4O3S/c1-13-9-16(12-23-20(13)22)15-7-5-14(6-8-15)10-19(26)24-18-11-17(27-25-18)21(2,3)4;1-5(2,3)4/h5-9,11-12H,10H2,1-4H3,(H2,22,23)(H,24,25,26);1H3,(H,2,3,4) |
| InChIKey | HZNUSHJIVSIBCJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|