C22H24FN3O6S — CID 162340119
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(4-fluoro-3-methylphenyl)-1,3-thiazol-4-yl]carbamate;(E)-but-2-enedioic acid (PubChem CID 162340119) has the molecular formula C22H24FN3O6S and a molecular weight of 477.51 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(4-fluoro-3-methylphenyl)-1,3-thiazol-4-yl]carbamate;(E)-but-2-enedioic acid.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(4-fluoro-3-methylphenyl)-1,3-thiazol-4-yl]carbamate;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 162340119 |
| Molecular Formula | C22H24FN3O6S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(4-fluoro-3-methylphenyl)-1,3-thiazol-4-yl]carbamate;(E)-but-2-enedioic acid |
| SMILES | Cc1cc(-c2scnc2NC(=O)O[C@H]2CN3CCC2CC3)ccc1F.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H20FN3O2S.C4H4O4/c1-11-8-13(2-3-14(11)19)16-17(20-10-25-16)21-18(23)24-15-9-22-6-4-12(15)5-7-22;5-3(6)1-2-4(7)8/h2-3,8,10,12,15H,4-7,9H2,1H3,(H,21,23);1-2H,(H,5,6)(H,7,8)/b;2-1+/t15-;/m0./s1 |
| InChIKey | QAUGNJJNLKUIFT-YAKGRJRBSA-N |
| XLogP | 3.61 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|