C10H23ClN2O2 — CID 162340751
(6-amino-2,6-dimethylheptan-2-yl) carbamate;hydrochloride (PubChem CID 162340751) has the molecular formula C10H23ClN2O2 and a molecular weight of 238.76 g/mol. Its IUPAC name is (6-amino-2,6-dimethylheptan-2-yl) carbamate;hydrochloride.
| Compound Name | (6-amino-2,6-dimethylheptan-2-yl) carbamate;hydrochloride |
|---|---|
| PubChem CID | 162340751 |
| Molecular Formula | C10H23ClN2O2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (6-amino-2,6-dimethylheptan-2-yl) carbamate;hydrochloride |
| SMILES | CC(C)(N)CCCC(C)(C)OC(N)=O.Cl |
| InChI | InChI=1S/C10H22N2O2.ClH/c1-9(2,12)6-5-7-10(3,4)14-8(11)13;/h5-7,12H2,1-4H3,(H2,11,13);1H |
| InChIKey | GIYXWVKBERKAQF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |