C27H43NO6 — CID 162340911
(1R,2S,6S,9S,10S,11R,12S,14S,15S,16S,18S,20S,23R,24R)-10,12,14,16,20-pentahydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-17-one (PubChem CID 162340911) has the molecular formula C27H43NO6 and a molecular weight of 477.64 g/mol. Its IUPAC name is (1R,2S,6S,9S,10S,11R,12S,14S,15S,16S,18S,20S,23R,24R)-10,12,14,16,20-pentahydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-17-one.
| Compound Name | (1R,2S,6S,9S,10S,11R,12S,14S,15S,16S,18S,20S,23R,24R)-10,12,14,16,20-pentahydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-17-one |
|---|---|
| PubChem CID | 162340911 |
| Molecular Formula | C27H43NO6 |
| Molecular Weight | 477.64 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | (1R,2S,6S,9S,10S,11R,12S,14S,15S,16S,18S,20S,23R,24R)-10,12,14,16,20-pentahydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-17-one |
| SMILES | C[C@H]1CC[C@@H]2N(C1)C[C@@H]1[C@H]([C@@H](O)C[C@@]3(O)[C@@H]4[C@H](O)C(=O)[C@H]5C[C@@H](O)CC[C@]5(C)[C@@H]4C[C@H]13)[C@]2(C)O |
| InChI | InChI=1S/C27H43NO6/c1-13-4-5-20-26(3,33)21-15(12-28(20)11-13)16-9-17-22(27(16,34)10-19(21)30)24(32)23(31)18-8-14(29)6-7-25(17,18)2/h13-22,24,29-30,32-34H,4-12H2,1-3H3/t13-,14-,15-,16+,17+,18+,19-,20-,21+,22-,24-,25+,26+,27-/m0/s1 |
| InChIKey | GNDFCKYSZIORHG-XASOEYGOSA-N |
| XLogP | 0.94 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.64 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |