About potassium;5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxylate;hydrate
potassium;5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxylate;hydrate (PubChem CID 162341841) has the molecular formula C4H3F3KN3O3
and a molecular weight of 237.18 g/mol. Its IUPAC name is potassium;5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxylate;hydrate.
Molecular Properties
| Compound Name | potassium;5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxylate;hydrate |
| PubChem CID | 162341841 |
| Molecular Formula | C4H3F3KN3O3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | potassium;5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxylate;hydrate |
| SMILES | O.O=C([O-])c1n[nH]c(C(F)(F)F)n1.[K+] |
| InChI | InChI=1S/C4H2F3N3O2.K.H2O/c5-4(6,7)3-8-1(2(11)12)9-10-3;;/h(H,11,12)(H,8,9,10);;1H2/q;+1;/p-1 |
| InChIKey | VBNSSPINPNDATO-UHFFFAOYSA-M |
| XLogP | -4.63 |
| TPSA | 113.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | -4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze potassium;5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxylate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxylate;hydrate?
The IUPAC name of potassium;5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxylate;hydrate (CID 162341841) is potassium;5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxylate;hydrate.
What is the SMILES notation for potassium;5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxylate;hydrate?
The canonical SMILES for potassium;5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxylate;hydrate is O.O=C([O-])c1n[nH]c(C(F)(F)F)n1.[K+].
What is the InChIKey of potassium;5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxylate;hydrate?
The InChIKey is VBNSSPINPNDATO-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H2F3N3O2.K.H2O/c5-4(6,7)3-8-1(2(11)12)9-10-3;;/h(H,11,12)(H,8,9,10);;1H2/q;+1;/p-1.
What are the key properties of potassium;5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxylate;hydrate?
potassium;5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxylate;hydrate has a molecular weight of 237.18 g/mol, XLogP of -4.63, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxylate;hydrate is sourced from PubChem (CID 162341841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).