C16H19BF3NO4 — CID 162341902
2,2,2-trifluoro-N-[(3S)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-3-yl]acetamide (PubChem CID 162341902) has the molecular formula C16H19BF3NO4 and a molecular weight of 357.14 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3S)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(3S)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-3-yl]acetamide |
|---|---|
| PubChem CID | 162341902 |
| Molecular Formula | C16H19BF3NO4 |
| Molecular Weight | 357.14 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3S)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-3-yl]acetamide |
| SMILES | CC1(C)OB(c2ccc3c(c2)[C@H](NC(=O)C(F)(F)F)CO3)OC1(C)C |
| InChI | InChI=1S/C16H19BF3NO4/c1-14(2)15(3,4)25-17(24-14)9-5-6-12-10(7-9)11(8-23-12)21-13(22)16(18,19)20/h5-7,11H,8H2,1-4H3,(H,21,22)/t11-/m1/s1 |
| InChIKey | HNONEROCWNGJFO-LLVKDONJSA-N |
| XLogP | 2.10 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.14 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|