C9H6BF6K — CID 162342116
potassium trifluoro-[(1R,2R)-2-(3,4,5-trifluorophenyl)cyclopropyl]boranuide (PubChem CID 162342116) has the molecular formula C9H6BF6K and a molecular weight of 278.05 g/mol. Its IUPAC name is potassium trifluoro-[(1R,2R)-2-(3,4,5-trifluorophenyl)cyclopropyl]boranuide.
| Compound Name | potassium trifluoro-[(1R,2R)-2-(3,4,5-trifluorophenyl)cyclopropyl]boranuide |
|---|---|
| PubChem CID | 162342116 |
| Molecular Formula | C9H6BF6K |
| Molecular Weight | 278.05 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | potassium trifluoro-[(1R,2R)-2-(3,4,5-trifluorophenyl)cyclopropyl]boranuide |
| SMILES | Fc1cc([C@@H]2C[C@H]2[B-](F)(F)F)cc(F)c1F.[K+] |
| InChI | InChI=1S/C9H6BF6.K/c11-7-1-4(2-8(12)9(7)13)5-3-6(5)10(14,15)16;/h1-2,5-6H,3H2;/q-1;+1/t5-,6+;/m0./s1 |
| InChIKey | TUSJVOOEIYGBLZ-RIHPBJNCSA-N |
| XLogP | 0.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.05 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|