About [(1R,2S)-2-aminocyclobutyl]methanol;hydrochloride
[(1R,2S)-2-aminocyclobutyl]methanol;hydrochloride (PubChem CID 162342272) has the molecular formula C5H12ClNO
and a molecular weight of 137.61 g/mol. Its IUPAC name is [(1R,2S)-2-aminocyclobutyl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [(1R,2S)-2-aminocyclobutyl]methanol;hydrochloride |
| PubChem CID | 162342272 |
| Molecular Formula | C5H12ClNO |
| Molecular Weight | 137.61 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | [(1R,2S)-2-aminocyclobutyl]methanol;hydrochloride |
| SMILES | Cl.N[C@H]1CC[C@H]1CO |
| InChI | InChI=1S/C5H11NO.ClH/c6-5-2-1-4(5)3-7;/h4-5,7H,1-3,6H2;1H/t4-,5-;/m0./s1 |
| InChIKey | XAYVFGCHLQIVEY-FHAQVOQBSA-N |
| XLogP | 0.14 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.61 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R,2S)-2-aminocyclobutyl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-aminocyclobutyl]methanol;hydrochloride?
The IUPAC name of [(1R,2S)-2-aminocyclobutyl]methanol;hydrochloride (CID 162342272) is [(1R,2S)-2-aminocyclobutyl]methanol;hydrochloride.
What is the SMILES notation for [(1R,2S)-2-aminocyclobutyl]methanol;hydrochloride?
The canonical SMILES for [(1R,2S)-2-aminocyclobutyl]methanol;hydrochloride is Cl.N[C@H]1CC[C@H]1CO.
What is the InChIKey of [(1R,2S)-2-aminocyclobutyl]methanol;hydrochloride?
The InChIKey is XAYVFGCHLQIVEY-FHAQVOQBSA-N. The full InChI is InChI=1S/C5H11NO.ClH/c6-5-2-1-4(5)3-7;/h4-5,7H,1-3,6H2;1H/t4-,5-;/m0./s1.
What are the key properties of [(1R,2S)-2-aminocyclobutyl]methanol;hydrochloride?
[(1R,2S)-2-aminocyclobutyl]methanol;hydrochloride has a molecular weight of 137.61 g/mol, XLogP of 0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-aminocyclobutyl]methanol;hydrochloride is sourced from PubChem (CID 162342272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).