C16H20BFO4 — CID 162342738
trans-(1S,2S)-2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylic acid (PubChem CID 162342738) has the molecular formula C16H20BFO4 and a molecular weight of 306.14 g/mol. Its IUPAC name is trans-(1S,2S)-2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 162342738 |
| Molecular Formula | C16H20BFO4 |
| Molecular Weight | 306.14 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | trans-(1S,2S)-2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)OB(c2ccc([C@H]3C[C@@H]3C(=O)O)cc2F)OC1(C)C |
| InChI | InChI=1S/C16H20BFO4/c1-15(2)16(3,4)22-17(21-15)12-6-5-9(7-13(12)18)10-8-11(10)14(19)20/h5-7,10-11H,8H2,1-4H3,(H,19,20)/t10-,11+/m1/s1 |
| InChIKey | HKQQOPNEQZHINJ-MNOVXSKESA-N |
| XLogP | 2.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.14 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|