About 5-iodo-1-[[4-(1,3-oxazol-5-yl)phenyl]methyl]pyrimidine-2,4-dione
5-iodo-1-[[4-(1,3-oxazol-5-yl)phenyl]methyl]pyrimidine-2,4-dione (PubChem CID 162342742) has the molecular formula C14H10IN3O3
and a molecular weight of 395.16 g/mol. Its IUPAC name is 5-iodo-1-[[4-(1,3-oxazol-5-yl)phenyl]methyl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-iodo-1-[[4-(1,3-oxazol-5-yl)phenyl]methyl]pyrimidine-2,4-dione |
| PubChem CID | 162342742 |
| Molecular Formula | C14H10IN3O3 |
| Molecular Weight | 395.16 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | 5-iodo-1-[[4-(1,3-oxazol-5-yl)phenyl]methyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccc(-c3cnco3)cc2)cc1I |
| InChI | InChI=1S/C14H10IN3O3/c15-11-7-18(14(20)17-13(11)19)6-9-1-3-10(4-2-9)12-5-16-8-21-12/h1-5,7-8H,6H2,(H,17,19,20) |
| InChIKey | FUMGKGZQYAUAEO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.16 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-1-[[4-(1,3-oxazol-5-yl)phenyl]methyl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-1-[[4-(1,3-oxazol-5-yl)phenyl]methyl]pyrimidine-2,4-dione?
The IUPAC name of 5-iodo-1-[[4-(1,3-oxazol-5-yl)phenyl]methyl]pyrimidine-2,4-dione (CID 162342742) is 5-iodo-1-[[4-(1,3-oxazol-5-yl)phenyl]methyl]pyrimidine-2,4-dione.
What is the SMILES notation for 5-iodo-1-[[4-(1,3-oxazol-5-yl)phenyl]methyl]pyrimidine-2,4-dione?
The canonical SMILES for 5-iodo-1-[[4-(1,3-oxazol-5-yl)phenyl]methyl]pyrimidine-2,4-dione is O=c1[nH]c(=O)n(Cc2ccc(-c3cnco3)cc2)cc1I.
What is the InChIKey of 5-iodo-1-[[4-(1,3-oxazol-5-yl)phenyl]methyl]pyrimidine-2,4-dione?
The InChIKey is FUMGKGZQYAUAEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10IN3O3/c15-11-7-18(14(20)17-13(11)19)6-9-1-3-10(4-2-9)12-5-16-8-21-12/h1-5,7-8H,6H2,(H,17,19,20).
What are the key properties of 5-iodo-1-[[4-(1,3-oxazol-5-yl)phenyl]methyl]pyrimidine-2,4-dione?
5-iodo-1-[[4-(1,3-oxazol-5-yl)phenyl]methyl]pyrimidine-2,4-dione has a molecular weight of 395.16 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-1-[[4-(1,3-oxazol-5-yl)phenyl]methyl]pyrimidine-2,4-dione is sourced from PubChem (CID 162342742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).