About 3,8-bis(trifluoromethyl)imidazo[1,5-a]pyridine
3,8-bis(trifluoromethyl)imidazo[1,5-a]pyridine (PubChem CID 162342835) has the molecular formula C9H4F6N2
and a molecular weight of 254.13 g/mol. Its IUPAC name is 3,8-bis(trifluoromethyl)imidazo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 3,8-bis(trifluoromethyl)imidazo[1,5-a]pyridine |
| PubChem CID | 162342835 |
| Molecular Formula | C9H4F6N2 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 3,8-bis(trifluoromethyl)imidazo[1,5-a]pyridine |
| SMILES | FC(F)(F)c1cccn2c(C(F)(F)F)ncc12 |
| InChI | InChI=1S/C9H4F6N2/c10-8(11,12)5-2-1-3-17-6(5)4-16-7(17)9(13,14)15/h1-4H |
| InChIKey | UBHQVQWTYZCNSH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,8-bis(trifluoromethyl)imidazo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-bis(trifluoromethyl)imidazo[1,5-a]pyridine?
The IUPAC name of 3,8-bis(trifluoromethyl)imidazo[1,5-a]pyridine (CID 162342835) is 3,8-bis(trifluoromethyl)imidazo[1,5-a]pyridine.
What is the SMILES notation for 3,8-bis(trifluoromethyl)imidazo[1,5-a]pyridine?
The canonical SMILES for 3,8-bis(trifluoromethyl)imidazo[1,5-a]pyridine is FC(F)(F)c1cccn2c(C(F)(F)F)ncc12.
What is the InChIKey of 3,8-bis(trifluoromethyl)imidazo[1,5-a]pyridine?
The InChIKey is UBHQVQWTYZCNSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F6N2/c10-8(11,12)5-2-1-3-17-6(5)4-16-7(17)9(13,14)15/h1-4H.
What are the key properties of 3,8-bis(trifluoromethyl)imidazo[1,5-a]pyridine?
3,8-bis(trifluoromethyl)imidazo[1,5-a]pyridine has a molecular weight of 254.13 g/mol, XLogP of 3.37, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-bis(trifluoromethyl)imidazo[1,5-a]pyridine is sourced from PubChem (CID 162342835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).