About cyclopropyl(1,3-thiazol-2-yl)methanamine;hydrochloride
cyclopropyl(1,3-thiazol-2-yl)methanamine;hydrochloride (PubChem CID 162343507) has the molecular formula C7H11ClN2S
and a molecular weight of 190.70 g/mol. Its IUPAC name is cyclopropyl(1,3-thiazol-2-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | cyclopropyl(1,3-thiazol-2-yl)methanamine;hydrochloride |
| PubChem CID | 162343507 |
| Molecular Formula | C7H11ClN2S |
| Molecular Weight | 190.70 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | cyclopropyl(1,3-thiazol-2-yl)methanamine;hydrochloride |
| SMILES | Cl.NC(c1nccs1)C1CC1 |
| InChI | InChI=1S/C7H10N2S.ClH/c8-6(5-1-2-5)7-9-3-4-10-7;/h3-6H,1-2,8H2;1H |
| InChIKey | YAIGFVSNDXHJDG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.70 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopropyl(1,3-thiazol-2-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl(1,3-thiazol-2-yl)methanamine;hydrochloride?
The IUPAC name of cyclopropyl(1,3-thiazol-2-yl)methanamine;hydrochloride (CID 162343507) is cyclopropyl(1,3-thiazol-2-yl)methanamine;hydrochloride.
What is the SMILES notation for cyclopropyl(1,3-thiazol-2-yl)methanamine;hydrochloride?
The canonical SMILES for cyclopropyl(1,3-thiazol-2-yl)methanamine;hydrochloride is Cl.NC(c1nccs1)C1CC1.
What is the InChIKey of cyclopropyl(1,3-thiazol-2-yl)methanamine;hydrochloride?
The InChIKey is YAIGFVSNDXHJDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2S.ClH/c8-6(5-1-2-5)7-9-3-4-10-7;/h3-6H,1-2,8H2;1H.
What are the key properties of cyclopropyl(1,3-thiazol-2-yl)methanamine;hydrochloride?
cyclopropyl(1,3-thiazol-2-yl)methanamine;hydrochloride has a molecular weight of 190.70 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl(1,3-thiazol-2-yl)methanamine;hydrochloride is sourced from PubChem (CID 162343507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).