C11H16ClNO2S — CID 162344454
(2R)-2-(3-methylsulfonylphenyl)pyrrolidine;hydrochloride (PubChem CID 162344454) has the molecular formula C11H16ClNO2S and a molecular weight of 261.77 g/mol. Its IUPAC name is (2R)-2-(3-methylsulfonylphenyl)pyrrolidine;hydrochloride.
| Compound Name | (2R)-2-(3-methylsulfonylphenyl)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 162344454 |
| Molecular Formula | C11H16ClNO2S |
| Molecular Weight | 261.77 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (2R)-2-(3-methylsulfonylphenyl)pyrrolidine;hydrochloride |
| SMILES | CS(=O)(=O)c1cccc([C@H]2CCCN2)c1.Cl |
| InChI | InChI=1S/C11H15NO2S.ClH/c1-15(13,14)10-5-2-4-9(8-10)11-6-3-7-12-11;/h2,4-5,8,11-12H,3,6-7H2,1H3;1H/t11-;/m1./s1 |
| InChIKey | WQGYEGYLZZJZAD-RFVHGSKJSA-N |
| XLogP | 1.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.77 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |