C9H12N2O2 — CID 162345306
3,6,8-trimethyl-8H-imidazo[5,1-c][1,4]oxazin-5-one (PubChem CID 162345306) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 3,6,8-trimethyl-8H-imidazo[5,1-c][1,4]oxazin-5-one.
| Compound Name | 3,6,8-trimethyl-8H-imidazo[5,1-c][1,4]oxazin-5-one |
|---|---|
| PubChem CID | 162345306 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 3,6,8-trimethyl-8H-imidazo[5,1-c][1,4]oxazin-5-one |
| SMILES | Cc1ncc2n1C(=O)C(C)OC2C |
| InChI | InChI=1S/C9H12N2O2/c1-5-8-4-10-7(3)11(8)9(12)6(2)13-5/h4-6H,1-3H3 |
| InChIKey | MCMIGANNYLVVES-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |