C19H25ClO3 — CID 162345579
(8S,9S,10R,13S,14S)-1-chloro-11-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 162345579) has the molecular formula C19H25ClO3 and a molecular weight of 336.86 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-1-chloro-11-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8S,9S,10R,13S,14S)-1-chloro-11-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 162345579 |
| Molecular Formula | C19H25ClO3 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (8S,9S,10R,13S,14S)-1-chloro-11-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CC(O)[C@H]3[C@@H](CCC4=CC(=O)CC(Cl)[C@@]43C)[C@@H]1CCC2=O |
| InChI | InChI=1S/C19H25ClO3/c1-18-9-14(22)17-12(13(18)5-6-16(18)23)4-3-10-7-11(21)8-15(20)19(10,17)2/h7,12-15,17,22H,3-6,8-9H2,1-2H3/t12-,13-,14?,15?,17+,18-,19+/m0/s1 |
| InChIKey | WAAAKWBZNKMMHX-UETZWZNOSA-N |
| XLogP | 3.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|