C9H12F7NO2 — CID 162347255
4,4,5,5,6,6,6-heptafluoro-2-hydroxy-N,N,2-trimethylhexanamide (PubChem CID 162347255) has the molecular formula C9H12F7NO2 and a molecular weight of 299.19 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-2-hydroxy-N,N,2-trimethylhexanamide.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-2-hydroxy-N,N,2-trimethylhexanamide |
|---|---|
| PubChem CID | 162347255 |
| Molecular Formula | C9H12F7NO2 |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-2-hydroxy-N,N,2-trimethylhexanamide |
| SMILES | CN(C)C(=O)C(C)(O)CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F7NO2/c1-6(19,5(18)17(2)3)4-7(10,11)8(12,13)9(14,15)16/h19H,4H2,1-3H3 |
| InChIKey | IKCVHSOJZCNRML-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|