C9H10F9NO2 — CID 162347495
4,4,5,5,6,6,7,7,7-nonafluoro-2-hydroxy-N,N-dimethylheptanamide (PubChem CID 162347495) has the molecular formula C9H10F9NO2 and a molecular weight of 335.17 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,7-nonafluoro-2-hydroxy-N,N-dimethylheptanamide.
| Compound Name | 4,4,5,5,6,6,7,7,7-nonafluoro-2-hydroxy-N,N-dimethylheptanamide |
|---|---|
| PubChem CID | 162347495 |
| Molecular Formula | C9H10F9NO2 |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 4,4,5,5,6,6,7,7,7-nonafluoro-2-hydroxy-N,N-dimethylheptanamide |
| SMILES | CN(C)C(=O)C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F9NO2/c1-19(2)5(21)4(20)3-6(10,11)7(12,13)8(14,15)9(16,17)18/h4,20H,3H2,1-2H3 |
| InChIKey | GQTVMIRCAFNYIA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|