C8H10F7NO2 — CID 162347505
4,4,5,5,6,6,6-heptafluoro-2-hydroxy-N,N-dimethylhexanamide (PubChem CID 162347505) has the molecular formula C8H10F7NO2 and a molecular weight of 285.16 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-2-hydroxy-N,N-dimethylhexanamide.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-2-hydroxy-N,N-dimethylhexanamide |
|---|---|
| PubChem CID | 162347505 |
| Molecular Formula | C8H10F7NO2 |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-2-hydroxy-N,N-dimethylhexanamide |
| SMILES | CN(C)C(=O)C(O)CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F7NO2/c1-16(2)5(18)4(17)3-6(9,10)7(11,12)8(13,14)15/h4,17H,3H2,1-2H3 |
| InChIKey | NRENWRPQQAQDDK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|