C10H10F11NO2 — CID 162347708
4,5,5,6,6,7,7,7-octafluoro-2-hydroxy-N,N-dimethyl-3-(trifluoromethyl)heptanamide (PubChem CID 162347708) has the molecular formula C10H10F11NO2 and a molecular weight of 385.17 g/mol. Its IUPAC name is 4,5,5,6,6,7,7,7-octafluoro-2-hydroxy-N,N-dimethyl-3-(trifluoromethyl)heptanamide.
| Compound Name | 4,5,5,6,6,7,7,7-octafluoro-2-hydroxy-N,N-dimethyl-3-(trifluoromethyl)heptanamide |
|---|---|
| PubChem CID | 162347708 |
| Molecular Formula | C10H10F11NO2 |
| Molecular Weight | 385.17 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 4,5,5,6,6,7,7,7-octafluoro-2-hydroxy-N,N-dimethyl-3-(trifluoromethyl)heptanamide |
| SMILES | CN(C)C(=O)C(O)C(C(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F11NO2/c1-22(2)6(24)4(23)3(8(14,15)16)5(11)7(12,13)9(17,18)10(19,20)21/h3-5,23H,1-2H3 |
| InChIKey | UBBSKNMCWPHAJT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.17 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|