C12H10F15NO2 — CID 162347717
4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-hydroxy-N,N-dimethyldecanamide (PubChem CID 162347717) has the molecular formula C12H10F15NO2 and a molecular weight of 485.19 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-hydroxy-N,N-dimethyldecanamide.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-hydroxy-N,N-dimethyldecanamide |
|---|---|
| PubChem CID | 162347717 |
| Molecular Formula | C12H10F15NO2 |
| Molecular Weight | 485.19 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-hydroxy-N,N-dimethyldecanamide |
| SMILES | CN(C)C(=O)C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H10F15NO2/c1-28(2)5(30)4(29)3-6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)27/h4,29H,3H2,1-2H3 |
| InChIKey | XYQUMLKHAOABNO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.19 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|